C20H27ClO5 — CID 67527463
7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[3-(hydroxymethyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid (PubChem CID 67527463) has the molecular formula C20H27ClO5 and a molecular weight of 382.88 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[3-(hydroxymethyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[3-(hydroxymethyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67527463 |
| Molecular Formula | C20H27ClO5 |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[3-(hydroxymethyl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@@H](COc2cccc(CO)c2)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C20H27ClO5/c21-18-11-19(23)17(13-26-15-7-5-6-14(10-15)12-22)16(18)8-3-1-2-4-9-20(24)25/h1,3,5-7,10,16-19,22-23H,2,4,8-9,11-13H2,(H,24,25)/t16-,17-,18-,19-/m1/s1 |
| InChIKey | CJLOKVYLUSHWAR-NCXUSEDFSA-N |
| XLogP | 3.36 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|