C21H28Cl2O5 — CID 67442311
(Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[[3-chloro-5-(2-hydroxyethyl)phenoxy]methyl]-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 67442311) has the molecular formula C21H28Cl2O5 and a molecular weight of 431.36 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[[3-chloro-5-(2-hydroxyethyl)phenoxy]methyl]-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[[3-chloro-5-(2-hydroxyethyl)phenoxy]methyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67442311 |
| Molecular Formula | C21H28Cl2O5 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | (Z)-7-[(1R,2S,3R,5S)-5-chloro-2-[[3-chloro-5-(2-hydroxyethyl)phenoxy]methyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](COc2cc(Cl)cc(CCO)c2)[C@H](O)C[C@@H]1Cl |
| InChI | InChI=1S/C21H28Cl2O5/c22-15-9-14(7-8-24)10-16(11-15)28-13-18-17(19(23)12-20(18)25)5-3-1-2-4-6-21(26)27/h1,3,9-11,17-20,24-25H,2,4-8,12-13H2,(H,26,27)/b3-1-/t17-,18-,19+,20-/m1/s1 |
| InChIKey | QKVOHAXCBDXLOS-UJGXHFLBSA-N |
| XLogP | 4.06 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|