C23H30Cl2O5 — CID 58378675
(Z)-7-[(1R,2S,3R,5R)-2-[[3-(acetyloxymethyl)-5-chlorophenoxy]methyl]-5-chloro-3-methylcyclopentyl]hept-5-enoic acid (PubChem CID 58378675) has the molecular formula C23H30Cl2O5 and a molecular weight of 457.39 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R,5R)-2-[[3-(acetyloxymethyl)-5-chlorophenoxy]methyl]-5-chloro-3-methylcyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R,5R)-2-[[3-(acetyloxymethyl)-5-chlorophenoxy]methyl]-5-chloro-3-methylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 58378675 |
| Molecular Formula | C23H30Cl2O5 |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (Z)-7-[(1R,2S,3R,5R)-2-[[3-(acetyloxymethyl)-5-chlorophenoxy]methyl]-5-chloro-3-methylcyclopentyl]hept-5-enoic acid |
| SMILES | CC(=O)OCc1cc(Cl)cc(OC[C@@H]2[C@@H](C/C=C\CCCC(=O)O)[C@H](Cl)C[C@H]2C)c1 |
| InChI | InChI=1S/C23H30Cl2O5/c1-15-9-22(25)20(7-5-3-4-6-8-23(27)28)21(15)14-30-19-11-17(10-18(24)12-19)13-29-16(2)26/h3,5,10-12,15,20-22H,4,6-9,13-14H2,1-2H3,(H,27,28)/b5-3-/t15-,20-,21+,22-/m1/s1 |
| InChIKey | BETIOJRYGUMIME-SAULANAUSA-N |
| XLogP | 5.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|