C24H31Cl3O2 — CID 58358417
prop-2-enyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-methylcyclopentyl]hept-5-enoate (PubChem CID 58358417) has the molecular formula C24H31Cl3O2 and a molecular weight of 457.87 g/mol. Its IUPAC name is prop-2-enyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-methylcyclopentyl]hept-5-enoate.
| Compound Name | prop-2-enyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-methylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 58358417 |
| Molecular Formula | C24H31Cl3O2 |
| Molecular Weight | 457.87 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | prop-2-enyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-methylcyclopentyl]hept-5-enoate |
| SMILES | C=CCOC(=O)CCC/C=C\C[C@@H]1[C@@H](CCc2cc(Cl)cc(Cl)c2)[C@H](C)C[C@H]1Cl |
| InChI | InChI=1S/C24H31Cl3O2/c1-3-12-29-24(28)9-7-5-4-6-8-22-21(17(2)13-23(22)27)11-10-18-14-19(25)16-20(26)15-18/h3-4,6,14-17,21-23H,1,5,7-13H2,2H3/b6-4-/t17-,21+,22-,23-/m1/s1 |
| InChIKey | KICBDKOMDDOSOC-DVFJHOKWSA-N |
| XLogP | 7.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.87 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|