C17H26O4 — CID 58180298
prop-2-enyl (Z)-7-[(1R,2S,3R)-2-(hydroxymethyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate (PubChem CID 58180298) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is prop-2-enyl (Z)-7-[(1R,2S,3R)-2-(hydroxymethyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | prop-2-enyl (Z)-7-[(1R,2S,3R)-2-(hydroxymethyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 58180298 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | prop-2-enyl (Z)-7-[(1R,2S,3R)-2-(hydroxymethyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate |
| SMILES | C=CCOC(=O)CCC/C=C\C[C@H]1C(=O)C[C@@H](C)[C@@H]1CO |
| InChI | InChI=1S/C17H26O4/c1-3-10-21-17(20)9-7-5-4-6-8-14-15(12-18)13(2)11-16(14)19/h3-4,6,13-15,18H,1,5,7-12H2,2H3/b6-4-/t13-,14-,15+/m1/s1 |
| InChIKey | GRSNUTZNZJOXNJ-IGSLQNPTSA-N |
| XLogP | 2.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|