C30H36O5 — CID 66602829
prop-2-enyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]hept-5-enoate (PubChem CID 66602829) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is prop-2-enyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | prop-2-enyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 66602829 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | prop-2-enyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]hept-5-enoate |
| SMILES | C=CCOC(=O)CCCC=CC[C@H]1C(=O)C[C@@H](O)[C@@H]1C=C[C@@H](O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H36O5/c1-2-19-35-30(34)12-6-4-3-5-11-26-27(29(33)21-28(26)32)18-17-25(31)16-14-22-13-15-23-9-7-8-10-24(23)20-22/h2-3,5,7-10,13,15,17-18,20,25-27,29,31,33H,1,4,6,11-12,14,16,19,21H2/t25-,26+,27+,29+/m0/s1 |
| InChIKey | NRBJVWBYCQNVIS-NFWVVERESA-N |
| XLogP | 5.10 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|