C26H35BrO5S — CID 66602424
prop-2-enyl 7-[(1R,2R,3R)-2-[(3S)-5-(4-bromo-2,5-dimethylthiophen-3-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate (PubChem CID 66602424) has the molecular formula C26H35BrO5S and a molecular weight of 539.53 g/mol. Its IUPAC name is prop-2-enyl 7-[(1R,2R,3R)-2-[(3S)-5-(4-bromo-2,5-dimethylthiophen-3-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | prop-2-enyl 7-[(1R,2R,3R)-2-[(3S)-5-(4-bromo-2,5-dimethylthiophen-3-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 66602424 |
| Molecular Formula | C26H35BrO5S |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | prop-2-enyl 7-[(1R,2R,3R)-2-[(3S)-5-(4-bromo-2,5-dimethylthiophen-3-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
| SMILES | C=CCOC(=O)CCCC=CC[C@H]1C(=O)C[C@@H](O)[C@@H]1C=C[C@@H](O)CCc1c(C)sc(C)c1Br |
| InChI | InChI=1S/C26H35BrO5S/c1-4-15-32-25(31)10-8-6-5-7-9-21-22(24(30)16-23(21)29)14-12-19(28)11-13-20-17(2)33-18(3)26(20)27/h4-5,7,12,14,19,21-22,24,28,30H,1,6,8-11,13,15-16H2,2-3H3/t19-,21+,22+,24+/m0/s1 |
| InChIKey | CQZCFXHEIMGUGW-IEEQIXEPSA-N |
| XLogP | 5.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|