C22H30Cl2O3 — CID 89075986
(Z)-7-[(1R,2R,3R,5R)-5-chloro-2-[2-(4-chloro-3,5-dimethylphenyl)ethyl]-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 89075986) has the molecular formula C22H30Cl2O3 and a molecular weight of 413.39 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5R)-5-chloro-2-[2-(4-chloro-3,5-dimethylphenyl)ethyl]-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5R)-5-chloro-2-[2-(4-chloro-3,5-dimethylphenyl)ethyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 89075986 |
| Molecular Formula | C22H30Cl2O3 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5R)-5-chloro-2-[2-(4-chloro-3,5-dimethylphenyl)ethyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | Cc1cc(CC[C@@H]2[C@@H](C/C=C\CCCC(=O)O)[C@H](Cl)C[C@H]2O)cc(C)c1Cl |
| InChI | InChI=1S/C22H30Cl2O3/c1-14-11-16(12-15(2)22(14)24)9-10-18-17(19(23)13-20(18)25)7-5-3-4-6-8-21(26)27/h3,5,11-12,17-20,25H,4,6-10,13H2,1-2H3,(H,26,27)/b5-3-/t17-,18-,19-,20-/m1/s1 |
| InChIKey | XKFWGJVIBDPKAE-LYHBZYCMSA-N |
| XLogP | 5.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|