C23H31ClO5 — CID 91099973
7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[(3R)-3-hydroxy-4-(4-hydroxy-3-methylphenyl)but-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 91099973) has the molecular formula C23H31ClO5 and a molecular weight of 422.95 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[(3R)-3-hydroxy-4-(4-hydroxy-3-methylphenyl)but-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[(3R)-3-hydroxy-4-(4-hydroxy-3-methylphenyl)but-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91099973 |
| Molecular Formula | C23H31ClO5 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[(3R)-3-hydroxy-4-(4-hydroxy-3-methylphenyl)but-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | Cc1cc(C[C@@H](O)C=C[C@@H]2[C@@H](CC=CCCCC(=O)O)[C@H](Cl)C[C@H]2O)ccc1O |
| InChI | InChI=1S/C23H31ClO5/c1-15-12-16(8-11-21(15)26)13-17(25)9-10-19-18(20(24)14-22(19)27)6-4-2-3-5-7-23(28)29/h2,4,8-12,17-20,22,25-27H,3,5-7,13-14H2,1H3,(H,28,29)/t17-,18+,19+,20+,22+/m0/s1 |
| InChIKey | RVZYLDOSYAWBKP-SXEONFLVSA-N |
| XLogP | 3.97 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|