C25H35ClO6 — CID 91445716
7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[3-hydroxy-4-[3-methoxy-5-(methoxymethyl)phenyl]but-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 91445716) has the molecular formula C25H35ClO6 and a molecular weight of 467.00 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[3-hydroxy-4-[3-methoxy-5-(methoxymethyl)phenyl]but-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[3-hydroxy-4-[3-methoxy-5-(methoxymethyl)phenyl]but-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91445716 |
| Molecular Formula | C25H35ClO6 |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[3-hydroxy-4-[3-methoxy-5-(methoxymethyl)phenyl]but-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | COCc1cc(CC(O)C=C[C@@H]2[C@@H](CC=CCCCC(=O)O)[C@H](Cl)C[C@H]2O)cc(OC)c1 |
| InChI | InChI=1S/C25H35ClO6/c1-31-16-18-11-17(13-20(14-18)32-2)12-19(27)9-10-22-21(23(26)15-24(22)28)7-5-3-4-6-8-25(29)30/h3,5,9-11,13-14,19,21-24,27-28H,4,6-8,12,15-16H2,1-2H3,(H,29,30)/t19?,21-,22-,23-,24-/m1/s1 |
| InChIKey | VNKAUYOBIWSEDJ-FUSHJSRTSA-N |
| XLogP | 4.11 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|