C25H34O7 — CID 91006256
7-[(1R,2R,3R)-3-hydroxy-2-[3-hydroxy-4-[3-methoxy-5-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 91006256) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-3-hydroxy-2-[3-hydroxy-4-[3-methoxy-5-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R)-3-hydroxy-2-[3-hydroxy-4-[3-methoxy-5-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91006256 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 7-[(1R,2R,3R)-3-hydroxy-2-[3-hydroxy-4-[3-methoxy-5-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | COCc1cc(CC(O)C=C[C@H]2[C@H](O)CC(=O)[C@@H]2CC=CCCCC(=O)O)cc(OC)c1 |
| InChI | InChI=1S/C25H34O7/c1-31-16-18-11-17(13-20(14-18)32-2)12-19(26)9-10-22-21(23(27)15-24(22)28)7-5-3-4-6-8-25(29)30/h3,5,9-11,13-14,19,21-22,24,26,28H,4,6-8,12,15-16H2,1-2H3,(H,29,30)/t19?,21-,22-,24-/m1/s1 |
| InChIKey | QIXGSTNHOZHIGX-TWCSLKCUSA-N |
| XLogP | 3.07 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|