C26H36O6 — CID 91170649
7-[(1R,2R,3R)-3-hydroxy-2-[3-hydroxy-4-[3-(propoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 91170649) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-3-hydroxy-2-[3-hydroxy-4-[3-(propoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R)-3-hydroxy-2-[3-hydroxy-4-[3-(propoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91170649 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 7-[(1R,2R,3R)-3-hydroxy-2-[3-hydroxy-4-[3-(propoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCOCc1cccc(CC(O)C=C[C@H]2[C@H](O)CC(=O)[C@@H]2CC=CCCCC(=O)O)c1 |
| InChI | InChI=1S/C26H36O6/c1-2-14-32-18-20-9-7-8-19(15-20)16-21(27)12-13-23-22(24(28)17-25(23)29)10-5-3-4-6-11-26(30)31/h3,5,7-9,12-13,15,21-23,25,27,29H,2,4,6,10-11,14,16-18H2,1H3,(H,30,31)/t21?,22-,23-,25-/m1/s1 |
| InChIKey | JTHIETVNJSGMIB-LEDDBULKSA-N |
| XLogP | 3.84 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|