C25H34O5 — CID 70018196
(Z)-7-[(1R,2R)-2-[(E,3R)-4-[3-(ethoxymethyl)phenyl]-3-hydroxybut-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70018196) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is (Z)-7-[(1R,2R)-2-[(E,3R)-4-[3-(ethoxymethyl)phenyl]-3-hydroxybut-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R)-2-[(E,3R)-4-[3-(ethoxymethyl)phenyl]-3-hydroxybut-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70018196 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (Z)-7-[(1R,2R)-2-[(E,3R)-4-[3-(ethoxymethyl)phenyl]-3-hydroxybut-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCOCc1cccc(C[C@@H](O)/C=C/[C@H]2CCC(=O)[C@@H]2C/C=C\CCCC(=O)O)c1 |
| InChI | InChI=1S/C25H34O5/c1-2-30-18-20-9-7-8-19(16-20)17-22(26)14-12-21-13-15-24(27)23(21)10-5-3-4-6-11-25(28)29/h3,5,7-9,12,14,16,21-23,26H,2,4,6,10-11,13,15,17-18H2,1H3,(H,28,29)/b5-3-,14-12+/t21-,22-,23+/m0/s1 |
| InChIKey | GRPQZGICOXQKPL-XGEIGSDESA-N |
| XLogP | 4.48 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|