C17H26O4 — CID 21403799
(E)-7-[2-[(E)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 21403799) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (E)-7-[2-[(E)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[2-[(E)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 21403799 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (E)-7-[2-[(E)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCC(O)/C=C/C1CCC(=O)C1C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C17H26O4/c1-2-14(18)11-9-13-10-12-16(19)15(13)7-5-3-4-6-8-17(20)21/h3,5,9,11,13-15,18H,2,4,6-8,10,12H2,1H3,(H,20,21)/b5-3+,11-9+ |
| InChIKey | NSFGETXCKCBYCI-QHROSOOBSA-N |
| XLogP | 3.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|