C21H32O3 — CID 57217500
7-[(1R,2R)-2-(7-methylocta-1,6-dienyl)-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 57217500) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(7-methylocta-1,6-dienyl)-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-(7-methylocta-1,6-dienyl)-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57217500 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 7-[(1R,2R)-2-(7-methylocta-1,6-dienyl)-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)=CCCCC=C[C@H]1CCC(=O)[C@@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C21H32O3/c1-17(2)11-7-3-4-8-12-18-15-16-20(22)19(18)13-9-5-6-10-14-21(23)24/h5,8-9,11-12,18-19H,3-4,6-7,10,13-16H2,1-2H3,(H,23,24)/t18-,19+/m0/s1 |
| InChIKey | PVLWHNFIQZEXHC-RBUKOAKNSA-N |
| XLogP | 5.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|