C24H40O4 — CID 163670021
(Z)-7-[(1S,2S)-2-(3-ethyl-3-hydroxy-4-methylnon-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 163670021) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is (Z)-7-[(1S,2S)-2-(3-ethyl-3-hydroxy-4-methylnon-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2S)-2-(3-ethyl-3-hydroxy-4-methylnon-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 163670021 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | (Z)-7-[(1S,2S)-2-(3-ethyl-3-hydroxy-4-methylnon-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(C)C(O)(C=C[C@@H]1CCC(=O)[C@H]1C/C=C\CCCC(=O)O)CC |
| InChI | InChI=1S/C24H40O4/c1-4-6-9-12-19(3)24(28,5-2)18-17-20-15-16-22(25)21(20)13-10-7-8-11-14-23(26)27/h7,10,17-21,28H,4-6,8-9,11-16H2,1-3H3,(H,26,27)/b10-7-,18-17?/t19?,20-,21-,24?/m0/s1 |
| InChIKey | JBSLATQQCYFSBK-UPLPGWOCSA-N |
| XLogP | 5.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|