C21H38O — CID 142894478
(2R)-3-[(E)-but-1-enyl]-2-[(Z)-hept-2-enyl]cyclopentan-1-one;pentane (PubChem CID 142894478) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is (2R)-3-[(E)-but-1-enyl]-2-[(Z)-hept-2-enyl]cyclopentan-1-one;pentane.
| Compound Name | (2R)-3-[(E)-but-1-enyl]-2-[(Z)-hept-2-enyl]cyclopentan-1-one;pentane |
|---|---|
| PubChem CID | 142894478 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | (2R)-3-[(E)-but-1-enyl]-2-[(Z)-hept-2-enyl]cyclopentan-1-one;pentane |
| SMILES | CC/C=C/C1CCC(=O)[C@@H]1C/C=C\CCCC.CCCCC |
| InChI | InChI=1S/C16H26O.C5H12/c1-3-5-7-8-9-11-15-14(10-6-4-2)12-13-16(15)17;1-3-5-4-2/h6,8-10,14-15H,3-5,7,11-13H2,1-2H3;3-5H2,1-2H3/b9-8-,10-6+;/t14?,15-;/m1./s1 |
| InChIKey | NSEWTTLFJILITL-DOXWFLNJSA-N |
| XLogP | 6.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|