C25H29ClO4S — CID 66876853
7-[(1R,2R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 66876853) has the molecular formula C25H29ClO4S and a molecular weight of 461.02 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 66876853 |
| Molecular Formula | C25H29ClO4S |
| Molecular Weight | 461.02 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 7-[(1R,2R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1C(=O)CC[C@@H]1C=CC(O)CCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C25H29ClO4S/c26-25-20-8-5-6-9-22(20)31-23(25)16-14-18(27)13-11-17-12-15-21(28)19(17)7-3-1-2-4-10-24(29)30/h1,3,5-6,8-9,11,13,17-19,27H,2,4,7,10,12,14-16H2,(H,29,30)/t17-,18?,19+/m0/s1 |
| InChIKey | VGFUIMKDELZYKH-LJJQOFDWSA-N |
| XLogP | 6.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.02 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|