C28H33ClO6S — CID 59738207
formyl (Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate (PubChem CID 59738207) has the molecular formula C28H33ClO6S and a molecular weight of 533.09 g/mol. Its IUPAC name is formyl (Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate.
| Compound Name | formyl (Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59738207 |
| Molecular Formula | C28H33ClO6S |
| Molecular Weight | 533.09 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | formyl (Z)-7-[(1R,4S,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
| SMILES | CC1(C)C(=O)[C@H](C/C=C\CCCC(=O)OC=O)[C@@H](/C=C/C(O)CCc2sc3ccccc3c2Cl)[C@@H]1O |
| InChI | InChI=1S/C28H33ClO6S/c1-28(2)26(33)19(9-5-3-4-6-12-24(32)35-17-30)20(27(28)34)15-13-18(31)14-16-23-25(29)21-10-7-8-11-22(21)36-23/h3,5,7-8,10-11,13,15,17-20,27,31,34H,4,6,9,12,14,16H2,1-2H3/b5-3-,15-13+/t18?,19-,20-,27+/m1/s1 |
| InChIKey | CBBYARCPSOORQM-MEKUEWHUSA-N |
| XLogP | 5.42 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.09 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|