C26H29ClO6S — CID 59738201
formyl (Z)-7-[(1R,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoate (PubChem CID 59738201) has the molecular formula C26H29ClO6S and a molecular weight of 505.03 g/mol. Its IUPAC name is formyl (Z)-7-[(1R,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoate.
| Compound Name | formyl (Z)-7-[(1R,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59738201 |
| Molecular Formula | C26H29ClO6S |
| Molecular Weight | 505.03 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | formyl (Z)-7-[(1R,5R)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoate |
| SMILES | O=COC(=O)CCC/C=C\C[C@H]1C(=O)C(O)C[C@@H]1/C=C/C(O)CCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C26H29ClO6S/c27-25-20-8-5-6-9-22(20)34-23(25)14-13-18(29)12-11-17-15-21(30)26(32)19(17)7-3-1-2-4-10-24(31)33-16-28/h1,3,5-6,8-9,11-12,16-19,21,29-30H,2,4,7,10,13-15H2/b3-1-,12-11+/t17-,18?,19+,21?/m0/s1 |
| InChIKey | AHPRKARQWQFCPA-GVCZTXPJSA-N |
| XLogP | 4.79 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.03 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|