C26H29ClO4S — CID 11698536
(Z)-7-[(1R,6R)-6-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-2-oxocyclohex-3-en-1-yl]hept-5-enoic acid (PubChem CID 11698536) has the molecular formula C26H29ClO4S and a molecular weight of 473.03 g/mol. Its IUPAC name is (Z)-7-[(1R,6R)-6-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-2-oxocyclohex-3-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,6R)-6-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-2-oxocyclohex-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 11698536 |
| Molecular Formula | C26H29ClO4S |
| Molecular Weight | 473.03 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (Z)-7-[(1R,6R)-6-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-2-oxocyclohex-3-en-1-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1C(=O)C=CC[C@@H]1/C=C/C(O)CCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C26H29ClO4S/c27-26-21-10-5-6-12-23(21)32-24(26)17-16-19(28)15-14-18-8-7-11-22(29)20(18)9-3-1-2-4-13-25(30)31/h1,3,5-7,10-12,14-15,18-20,28H,2,4,8-9,13,16-17H2,(H,30,31)/b3-1-,15-14+/t18-,19?,20-/m1/s1 |
| InChIKey | NFVFTBFIHFMHHV-WOMWZYENSA-N |
| XLogP | 6.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.03 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|