C25H29ClO5S — CID 15981089
(Z)-7-[(1S,5S)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoic acid (PubChem CID 15981089) has the molecular formula C25H29ClO5S and a molecular weight of 477.02 g/mol. Its IUPAC name is (Z)-7-[(1S,5S)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,5S)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 15981089 |
| Molecular Formula | C25H29ClO5S |
| Molecular Weight | 477.02 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (Z)-7-[(1S,5S)-5-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1C(=O)C(O)C[C@H]1/C=C/C(O)CCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C25H29ClO5S/c26-24-19-8-5-6-9-21(19)32-22(24)14-13-17(27)12-11-16-15-20(28)25(31)18(16)7-3-1-2-4-10-23(29)30/h1,3,5-6,8-9,11-12,16-18,20,27-28H,2,4,7,10,13-15H2,(H,29,30)/b3-1-,12-11+/t16-,17?,18+,20?/m1/s1 |
| InChIKey | PABGCWFYQCPSHO-MIDIRKCASA-N |
| XLogP | 5.17 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.02 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|