C25H34O6 — CID 90926067
7-[(1R,2R)-2-[4-[3-(ethoxymethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 90926067) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[4-[3-(ethoxymethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[4-[3-(ethoxymethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 90926067 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 7-[(1R,2R)-2-[4-[3-(ethoxymethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCOCc1cccc(CC(O)C=C[C@H]2C(O)CC(=O)[C@@H]2CC=CCCCC(=O)O)c1 |
| InChI | InChI=1S/C25H34O6/c1-2-31-17-19-9-7-8-18(14-19)15-20(26)12-13-22-21(23(27)16-24(22)28)10-5-3-4-6-11-25(29)30/h3,5,7-9,12-14,20-22,24,26,28H,2,4,6,10-11,15-17H2,1H3,(H,29,30)/t20?,21-,22-,24?/m1/s1 |
| InChIKey | QCQFUBJMYZHZAC-VCUAKTQDSA-N |
| XLogP | 3.45 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|