C28H35ClO4 — CID 67527965
7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid (PubChem CID 67527965) has the molecular formula C28H35ClO4 and a molecular weight of 471.04 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67527965 |
| Molecular Formula | C28H35ClO4 |
| Molecular Weight | 471.04 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)(c1ccccc1)c1ccc(OC[C@@H]2[C@@H](CC=CCCCC(=O)O)[C@H](Cl)C[C@H]2O)cc1 |
| InChI | InChI=1S/C28H35ClO4/c1-28(2,20-10-6-5-7-11-20)21-14-16-22(17-15-21)33-19-24-23(25(29)18-26(24)30)12-8-3-4-9-13-27(31)32/h3,5-8,10-11,14-17,23-26,30H,4,9,12-13,18-19H2,1-2H3,(H,31,32)/t23-,24-,25-,26-/m1/s1 |
| InChIKey | RHFVHRRQXQAMMP-VEYUFSJPSA-N |
| XLogP | 6.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.04 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|