C20H25Cl3O4 — CID 67534379
methyl (Z)-7-[5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoate (PubChem CID 67534379) has the molecular formula C20H25Cl3O4 and a molecular weight of 435.78 g/mol. Its IUPAC name is methyl (Z)-7-[5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67534379 |
| Molecular Formula | C20H25Cl3O4 |
| Molecular Weight | 435.78 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | methyl (Z)-7-[5-chloro-2-[(3,5-dichlorophenoxy)methyl]-3-hydroxycyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\CC1C(Cl)CC(O)C1COc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H25Cl3O4/c1-26-20(25)7-5-3-2-4-6-16-17(19(24)11-18(16)23)12-27-15-9-13(21)8-14(22)10-15/h2,4,8-10,16-19,24H,3,5-7,11-12H2,1H3/b4-2- |
| InChIKey | XTXWHTARIZYNPP-RQOWECAXSA-N |
| XLogP | 5.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.78 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|