C23H29BrCl2O5 — CID 91515774
7-[(1R,2R)-2-[2-[3-(acetyloxymethyl)-5-chlorophenyl]ethyl]-4-bromo-3-chloro-5-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 91515774) has the molecular formula C23H29BrCl2O5 and a molecular weight of 536.29 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[2-[3-(acetyloxymethyl)-5-chlorophenyl]ethyl]-4-bromo-3-chloro-5-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[2-[3-(acetyloxymethyl)-5-chlorophenyl]ethyl]-4-bromo-3-chloro-5-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91515774 |
| Molecular Formula | C23H29BrCl2O5 |
| Molecular Weight | 536.29 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 7-[(1R,2R)-2-[2-[3-(acetyloxymethyl)-5-chlorophenyl]ethyl]-4-bromo-3-chloro-5-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CC(=O)OCc1cc(Cl)cc(CC[C@H]2C(Cl)C(Br)C(O)[C@@H]2CC=CCCCC(=O)O)c1 |
| InChI | InChI=1S/C23H29BrCl2O5/c1-14(27)31-13-16-10-15(11-17(25)12-16)8-9-18-19(23(30)21(24)22(18)26)6-4-2-3-5-7-20(28)29/h2,4,10-12,18-19,21-23,30H,3,5-9,13H2,1H3,(H,28,29)/t18-,19-,21?,22?,23?/m1/s1 |
| InChIKey | IZAINMBQGQWKGB-OEDVANPMSA-N |
| XLogP | 5.51 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.29 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|