C21H26BrCl2NO4S — CID 91535349
7-[(1S,2S)-2-[[2-(acetyloxymethyl)-6-chloro-4-pyridinyl]sulfanylmethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoic acid (PubChem CID 91535349) has the molecular formula C21H26BrCl2NO4S and a molecular weight of 539.32 g/mol. Its IUPAC name is 7-[(1S,2S)-2-[[2-(acetyloxymethyl)-6-chloro-4-pyridinyl]sulfanylmethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2S)-2-[[2-(acetyloxymethyl)-6-chloro-4-pyridinyl]sulfanylmethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91535349 |
| Molecular Formula | C21H26BrCl2NO4S |
| Molecular Weight | 539.32 g/mol |
| Exact Mass | 537.01 |
| IUPAC Name | 7-[(1S,2S)-2-[[2-(acetyloxymethyl)-6-chloro-4-pyridinyl]sulfanylmethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoic acid |
| SMILES | CC(=O)OCc1cc(SC[C@H]2C(Cl)C(Br)C[C@@H]2CC=CCCCC(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C21H26BrCl2NO4S/c1-13(26)29-11-15-9-16(10-19(23)25-15)30-12-17-14(8-18(22)21(17)24)6-4-2-3-5-7-20(27)28/h2,4,9-10,14,17-18,21H,3,5-8,11-12H2,1H3,(H,27,28)/t14-,17+,18?,21?/m0/s1 |
| InChIKey | RSECTLDQPATOCT-FTLXFRSTSA-N |
| XLogP | 6.10 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.32 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|