C22H30ClIO2 — CID 24804745
(E)-7-[(1S,2R)-3-chloro-2-[2-(2,6-dimethylphenyl)ethyl]-4-iodocyclopentyl]hept-5-enoic acid (PubChem CID 24804745) has the molecular formula C22H30ClIO2 and a molecular weight of 488.84 g/mol. Its IUPAC name is (E)-7-[(1S,2R)-3-chloro-2-[2-(2,6-dimethylphenyl)ethyl]-4-iodocyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[(1S,2R)-3-chloro-2-[2-(2,6-dimethylphenyl)ethyl]-4-iodocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 24804745 |
| Molecular Formula | C22H30ClIO2 |
| Molecular Weight | 488.84 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (E)-7-[(1S,2R)-3-chloro-2-[2-(2,6-dimethylphenyl)ethyl]-4-iodocyclopentyl]hept-5-enoic acid |
| SMILES | Cc1cccc(C)c1CC[C@H]1C(Cl)C(I)C[C@@H]1C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C22H30ClIO2/c1-15-8-7-9-16(2)18(15)12-13-19-17(14-20(24)22(19)23)10-5-3-4-6-11-21(25)26/h3,5,7-9,17,19-20,22H,4,6,10-14H2,1-2H3,(H,25,26)/b5-3+/t17-,19+,20?,22?/m0/s1 |
| InChIKey | GASMGSDZOTZZFN-ZNKXRROSSA-N |
| XLogP | 6.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.84 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|