C28H42O2 — CID 142043708
(Z)-7-[(1R)-2-[(1E)-7-phenylhepta-1,6-dienyl]cyclopentyl]hept-5-enoic acid;propane (PubChem CID 142043708) has the molecular formula C28H42O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is (Z)-7-[(1R)-2-[(1E)-7-phenylhepta-1,6-dienyl]cyclopentyl]hept-5-enoic acid;propane.
| Compound Name | (Z)-7-[(1R)-2-[(1E)-7-phenylhepta-1,6-dienyl]cyclopentyl]hept-5-enoic acid;propane |
|---|---|
| PubChem CID | 142043708 |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | (Z)-7-[(1R)-2-[(1E)-7-phenylhepta-1,6-dienyl]cyclopentyl]hept-5-enoic acid;propane |
| SMILES | CCC.O=C(O)CCC/C=C\C[C@H]1CCCC1/C=C/CCCC=Cc1ccccc1 |
| InChI | InChI=1S/C25H34O2.C3H8/c26-25(27)21-12-5-4-11-18-24-20-13-19-23(24)17-10-3-1-2-7-14-22-15-8-6-9-16-22;1-3-2/h4,6-11,14-17,23-24H,1-3,5,12-13,18-21H2,(H,26,27);3H2,1-2H3/b11-4-,14-7?,17-10+;/t23?,24-;/m0./s1 |
| InChIKey | SGLPLIJCBRTEMS-NTOYSCMNSA-N |
| XLogP | 8.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|