C23H44O3 — CID 158178848
(Z)-7-[(2S)-2-[(1E,3S,5Z)-3-hydroxyocta-1,5-dienyl]cyclopentyl]hept-5-enoic acid;methane (PubChem CID 158178848) has the molecular formula C23H44O3 and a molecular weight of 368.60 g/mol. Its IUPAC name is (Z)-7-[(2S)-2-[(1E,3S,5Z)-3-hydroxyocta-1,5-dienyl]cyclopentyl]hept-5-enoic acid;methane.
| Compound Name | (Z)-7-[(2S)-2-[(1E,3S,5Z)-3-hydroxyocta-1,5-dienyl]cyclopentyl]hept-5-enoic acid;methane |
|---|---|
| PubChem CID | 158178848 |
| Molecular Formula | C23H44O3 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.33 |
| IUPAC Name | (Z)-7-[(2S)-2-[(1E,3S,5Z)-3-hydroxyocta-1,5-dienyl]cyclopentyl]hept-5-enoic acid;methane |
| SMILES | C.C.C.CC/C=C\C[C@H](O)/C=C/[C@H]1CCCC1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O3.3CH4/c1-2-3-6-13-19(21)16-15-18-12-9-11-17(18)10-7-4-5-8-14-20(22)23;;;/h3-4,6-7,15-19,21H,2,5,8-14H2,1H3,(H,22,23);3*1H4/b6-3-,7-4-,16-15+;;;/t17?,18-,19+;;;/m1.../s1 |
| InChIKey | FYIGAZUWVDPBOU-QRAWRLTLSA-N |
| XLogP | 6.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|