C20H34O5 — CID 172859860
(Z)-7-[(1R,2S)-2-[(E)-8,8,8-trihydroxyoct-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 172859860) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (Z)-7-[(1R,2S)-2-[(E)-8,8,8-trihydroxyoct-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S)-2-[(E)-8,8,8-trihydroxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 172859860 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (Z)-7-[(1R,2S)-2-[(E)-8,8,8-trihydroxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1CCC[C@@H]1/C=C/CCCCCC(O)(O)O |
| InChI | InChI=1S/C20H34O5/c21-19(22)15-8-4-3-7-12-18-14-10-13-17(18)11-6-2-1-5-9-16-20(23,24)25/h3,6-7,11,17-18,23-25H,1-2,4-5,8-10,12-16H2,(H,21,22)/b7-3-,11-6+/t17-,18-/m0/s1 |
| InChIKey | ZEYRIYIMZCGLDM-JFQFUZGZSA-N |
| XLogP | 3.74 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|