C20H38O3 — CID 22806593
7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptane-1,1,1-triol (PubChem CID 22806593) has the molecular formula C20H38O3 and a molecular weight of 326.52 g/mol. Its IUPAC name is 7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptane-1,1,1-triol.
| Compound Name | 7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptane-1,1,1-triol |
|---|---|
| PubChem CID | 22806593 |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | 7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptane-1,1,1-triol |
| SMILES | CCCCCC/C=C/[C@H]1CCC[C@@H]1CCCCCCC(O)(O)O |
| InChI | InChI=1S/C20H38O3/c1-2-3-4-5-6-9-13-18-15-12-16-19(18)14-10-7-8-11-17-20(21,22)23/h9,13,18-19,21-23H,2-8,10-12,14-17H2,1H3/b13-9+/t18-,19-/m0/s1 |
| InChIKey | NOGIPOAMJSDGEZ-QZCZHZTGSA-N |
| XLogP | 4.90 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|