C18H34 — CID 57208153
trans-(1S,2S)-1-hept-1-enyl-2-hexylcyclopentane (PubChem CID 57208153) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is trans-(1S,2S)-1-hept-1-enyl-2-hexylcyclopentane.
| Compound Name | trans-(1S,2S)-1-hept-1-enyl-2-hexylcyclopentane |
|---|---|
| PubChem CID | 57208153 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | trans-(1S,2S)-1-hept-1-enyl-2-hexylcyclopentane |
| SMILES | CCCCCC=C[C@H]1CCC[C@@H]1CCCCCC |
| InChI | InChI=1S/C18H34/c1-3-5-7-9-11-14-18-16-12-15-17(18)13-10-8-6-4-2/h11,14,17-18H,3-10,12-13,15-16H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | IHZORMYTYOSCSD-ROUUACIJSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|