C20H36O2S — CID 57306372
2-[4-[(1R,2S)-2-non-1-enylcyclopentyl]butylsulfanyl]acetic acid (PubChem CID 57306372) has the molecular formula C20H36O2S and a molecular weight of 340.57 g/mol. Its IUPAC name is 2-[4-[(1R,2S)-2-non-1-enylcyclopentyl]butylsulfanyl]acetic acid.
| Compound Name | 2-[4-[(1R,2S)-2-non-1-enylcyclopentyl]butylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 57306372 |
| Molecular Formula | C20H36O2S |
| Molecular Weight | 340.57 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-[4-[(1R,2S)-2-non-1-enylcyclopentyl]butylsulfanyl]acetic acid |
| SMILES | CCCCCCCC=C[C@H]1CCC[C@@H]1CCCCSCC(=O)O |
| InChI | InChI=1S/C20H36O2S/c1-2-3-4-5-6-7-8-12-18-14-11-15-19(18)13-9-10-16-23-17-20(21)22/h8,12,18-19H,2-7,9-11,13-17H2,1H3,(H,21,22)/t18-,19-/m0/s1 |
| InChIKey | AWUSOIGJLYBFDV-OALUTQOASA-N |
| XLogP | 6.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|