C21H38O2S — CID 57231144
2-[4-[(1R,2S)-2-dec-1-enylcyclopentyl]butylsulfanyl]acetic acid (PubChem CID 57231144) has the molecular formula C21H38O2S and a molecular weight of 354.60 g/mol. Its IUPAC name is 2-[4-[(1R,2S)-2-dec-1-enylcyclopentyl]butylsulfanyl]acetic acid.
| Compound Name | 2-[4-[(1R,2S)-2-dec-1-enylcyclopentyl]butylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 57231144 |
| Molecular Formula | C21H38O2S |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 2-[4-[(1R,2S)-2-dec-1-enylcyclopentyl]butylsulfanyl]acetic acid |
| SMILES | CCCCCCCCC=C[C@H]1CCC[C@@H]1CCCCSCC(=O)O |
| InChI | InChI=1S/C21H38O2S/c1-2-3-4-5-6-7-8-9-13-19-15-12-16-20(19)14-10-11-17-24-18-21(22)23/h9,13,19-20H,2-8,10-12,14-18H2,1H3,(H,22,23)/t19-,20-/m0/s1 |
| InChIKey | KZZBPURYKGGVSN-PMACEKPBSA-N |
| XLogP | 6.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|