C20H36O3 — CID 154418264
5-hydroxy-7-[(1R,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid (PubChem CID 154418264) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is 5-hydroxy-7-[(1R,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid.
| Compound Name | 5-hydroxy-7-[(1R,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 154418264 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 5-hydroxy-7-[(1R,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid |
| SMILES | CCCCCC/C=C/[C@H]1CCC[C@@H]1CCC(O)CCCC(=O)O |
| InChI | InChI=1S/C20H36O3/c1-2-3-4-5-6-7-10-17-11-8-12-18(17)15-16-19(21)13-9-14-20(22)23/h7,10,17-19,21H,2-6,8-9,11-16H2,1H3,(H,22,23)/b10-7+/t17-,18+,19?/m0/s1 |
| InChIKey | GABCIJWCDMSAIN-PPLPCLRRSA-N |
| XLogP | 5.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|