C24H41NO3 — CID 153363841
4-[[(Z)-7-[(1R)-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-enoyl]amino]butanoic acid (PubChem CID 153363841) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is 4-[[(Z)-7-[(1R)-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-enoyl]amino]butanoic acid.
| Compound Name | 4-[[(Z)-7-[(1R)-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 153363841 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | 4-[[(Z)-7-[(1R)-2-[(E)-oct-1-enyl]cyclopentyl]hept-5-enoyl]amino]butanoic acid |
| SMILES | CCCCCC/C=C/C1CCC[C@@H]1C/C=C\CCCC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C24H41NO3/c1-2-3-4-5-6-9-14-21-16-12-17-22(21)15-10-7-8-11-18-23(26)25-20-13-19-24(27)28/h7,9-10,14,21-22H,2-6,8,11-13,15-20H2,1H3,(H,25,26)(H,27,28)/b10-7-,14-9+/t21?,22-/m0/s1 |
| InChIKey | BVLZXLQBERFSGO-OCERCOQDSA-N |
| XLogP | 6.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|