C22H40 — CID 54243743
trans-(1S,2R)-1-dec-1-enyl-2-hept-2-enylcyclopentane (PubChem CID 54243743) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is trans-(1S,2R)-1-dec-1-enyl-2-hept-2-enylcyclopentane.
| Compound Name | trans-(1S,2R)-1-dec-1-enyl-2-hept-2-enylcyclopentane |
|---|---|
| PubChem CID | 54243743 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | trans-(1S,2R)-1-dec-1-enyl-2-hept-2-enylcyclopentane |
| SMILES | CCCCC=CC[C@H]1CCC[C@@H]1C=CCCCCCCCC |
| InChI | InChI=1S/C22H40/c1-3-5-7-9-10-11-13-15-18-22-20-16-19-21(22)17-14-12-8-6-4-2/h12,14-15,18,21-22H,3-11,13,16-17,19-20H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | QRUNIJMKJYKNSQ-VXKWHMMOSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|