C25H44O4 — CID 70607210
[(Z)-8-[(1R,2S)-2-[(E)-dec-1-enyl]cyclopentyl]-2,2-dihydroxyoct-6-enyl] acetate (PubChem CID 70607210) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is [(Z)-8-[(1R,2S)-2-[(E)-dec-1-enyl]cyclopentyl]-2,2-dihydroxyoct-6-enyl] acetate.
| Compound Name | [(Z)-8-[(1R,2S)-2-[(E)-dec-1-enyl]cyclopentyl]-2,2-dihydroxyoct-6-enyl] acetate |
|---|---|
| PubChem CID | 70607210 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | [(Z)-8-[(1R,2S)-2-[(E)-dec-1-enyl]cyclopentyl]-2,2-dihydroxyoct-6-enyl] acetate |
| SMILES | CCCCCCCC/C=C/[C@H]1CCC[C@@H]1C/C=C\CCCC(O)(O)COC(C)=O |
| InChI | InChI=1S/C25H44O4/c1-3-4-5-6-7-8-9-12-16-23-18-15-19-24(23)17-13-10-11-14-20-25(27,28)21-29-22(2)26/h10,12-13,16,23-24,27-28H,3-9,11,14-15,17-21H2,1-2H3/b13-10-,16-12+/t23-,24-/m0/s1 |
| InChIKey | HLPSMPQLYKEULL-NBQCTZGWSA-N |
| XLogP | 6.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|