C26H46O3 — CID 54287765
8-[(1R,2S)-2-[3-(1-hexylcyclobutyl)prop-1-enyl]cyclopentyl]oct-6-ene-1,2,2-triol (PubChem CID 54287765) has the molecular formula C26H46O3 and a molecular weight of 406.65 g/mol. Its IUPAC name is 8-[(1R,2S)-2-[3-(1-hexylcyclobutyl)prop-1-enyl]cyclopentyl]oct-6-ene-1,2,2-triol.
| Compound Name | 8-[(1R,2S)-2-[3-(1-hexylcyclobutyl)prop-1-enyl]cyclopentyl]oct-6-ene-1,2,2-triol |
|---|---|
| PubChem CID | 54287765 |
| Molecular Formula | C26H46O3 |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.34 |
| IUPAC Name | 8-[(1R,2S)-2-[3-(1-hexylcyclobutyl)prop-1-enyl]cyclopentyl]oct-6-ene-1,2,2-triol |
| SMILES | CCCCCCC1(CC=C[C@H]2CCC[C@@H]2CC=CCCCC(O)(O)CO)CCC1 |
| InChI | InChI=1S/C26H46O3/c1-2-3-4-8-17-25(19-12-20-25)18-11-16-24-15-10-14-23(24)13-7-5-6-9-21-26(28,29)22-27/h5,7,11,16,23-24,27-29H,2-4,6,8-10,12-15,17-22H2,1H3/t23-,24+/m0/s1 |
| InChIKey | RVIZKNPEDXOONL-BJKOFHAPSA-N |
| XLogP | 6.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|