C29H52O5 — CID 57118212
8-[(1S,2S)-2-[3-(1-hexylcyclobutyl)prop-1-enyl]cyclopentyl]-3,3,4-trihydroxy-1-propoxyoctan-2-one (PubChem CID 57118212) has the molecular formula C29H52O5 and a molecular weight of 480.73 g/mol. Its IUPAC name is 8-[(1S,2S)-2-[3-(1-hexylcyclobutyl)prop-1-enyl]cyclopentyl]-3,3,4-trihydroxy-1-propoxyoctan-2-one.
| Compound Name | 8-[(1S,2S)-2-[3-(1-hexylcyclobutyl)prop-1-enyl]cyclopentyl]-3,3,4-trihydroxy-1-propoxyoctan-2-one |
|---|---|
| PubChem CID | 57118212 |
| Molecular Formula | C29H52O5 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | 8-[(1S,2S)-2-[3-(1-hexylcyclobutyl)prop-1-enyl]cyclopentyl]-3,3,4-trihydroxy-1-propoxyoctan-2-one |
| SMILES | CCCCCCC1(CC=C[C@H]2CCC[C@@H]2CCCCC(O)C(O)(O)C(=O)COCCC)CCC1 |
| InChI | InChI=1S/C29H52O5/c1-3-5-6-9-18-28(20-12-21-28)19-11-16-25-15-10-14-24(25)13-7-8-17-26(30)29(32,33)27(31)23-34-22-4-2/h11,16,24-26,30,32-33H,3-10,12-15,17-23H2,1-2H3/t24-,25+,26?/m0/s1 |
| InChIKey | KVVDBGZQBMPNHJ-LHJLODMPSA-N |
| XLogP | 6.09 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|