2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid

C19H36O3 — CID 22791217

IUPAC2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid
SMILESCCCCCCCC[C@H]1CCC[C@@H]1CCCCOCC(=O)O
InChIInChI=1S/C19H36O3/c1-2-3-4-5-6-7-11-17-13-10-14-18(17)12-8-9-15-22-16-19(20)21/h17-18H,2-16H2,1H3,(H,20,21)/t17-,18-/m0/s1
InChIKeyJFDKJICTZQDECZ-ROUUACIJSA-N
MW312.49 g/mol
LogP5.42
Rot. Bonds14

About 2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid

2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid (PubChem CID 22791217) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is 2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid.

Molecular Properties

Compound Name2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid
PubChem CID22791217
Molecular FormulaC19H36O3
Molecular Weight312.49 g/mol
Exact Mass312.27
IUPAC Name2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid
SMILESCCCCCCCC[C@H]1CCC[C@@H]1CCCCOCC(=O)O
InChIInChI=1S/C19H36O3/c1-2-3-4-5-6-7-11-17-13-10-14-18(17)12-8-9-15-22-16-19(20)21/h17-18H,2-16H2,1H3,(H,20,21)/t17-,18-/m0/s1
InChIKeyJFDKJICTZQDECZ-ROUUACIJSA-N
XLogP5.42
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds14
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500312.49
LogP ≤ 55.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid?
The IUPAC name of 2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid (CID 22791217) is 2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid.
What is the SMILES notation for 2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid?
The canonical SMILES for 2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid is CCCCCCCC[C@H]1CCC[C@@H]1CCCCOCC(=O)O.
What is the InChIKey of 2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid?
The InChIKey is JFDKJICTZQDECZ-ROUUACIJSA-N. The full InChI is InChI=1S/C19H36O3/c1-2-3-4-5-6-7-11-17-13-10-14-18(17)12-8-9-15-22-16-19(20)21/h17-18H,2-16H2,1H3,(H,20,21)/t17-,18-/m0/s1.
What are the key properties of 2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid?
2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid has a molecular weight of 312.49 g/mol, XLogP of 5.42, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1R,2S)-2-octylcyclopentyl]butoxy]acetic acid is sourced from PubChem (CID 22791217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).