C25H46O2 — CID 57092877
trans-(1R,2R)-2-butyl-1-[3-[(1S,2S)-2-(8-hydroxyoctyl)cyclopentyl]prop-2-enyl]cyclopentan-1-ol (PubChem CID 57092877) has the molecular formula C25H46O2 and a molecular weight of 378.64 g/mol. Its IUPAC name is trans-(1R,2R)-2-butyl-1-[3-[(1S,2S)-2-(8-hydroxyoctyl)cyclopentyl]prop-2-enyl]cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-butyl-1-[3-[(1S,2S)-2-(8-hydroxyoctyl)cyclopentyl]prop-2-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 57092877 |
| Molecular Formula | C25H46O2 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.35 |
| IUPAC Name | trans-(1R,2R)-2-butyl-1-[3-[(1S,2S)-2-(8-hydroxyoctyl)cyclopentyl]prop-2-enyl]cyclopentan-1-ol |
| SMILES | CCCC[C@@H]1CCC[C@@]1(O)CC=C[C@H]1CCC[C@@H]1CCCCCCCCO |
| InChI | InChI=1S/C25H46O2/c1-2-3-17-24-18-12-20-25(24,27)19-11-16-23-15-10-14-22(23)13-8-6-4-5-7-9-21-26/h11,16,22-24,26-27H,2-10,12-15,17-21H2,1H3/t22-,23+,24+,25-/m0/s1 |
| InChIKey | SHOPDFKJBQKVGN-LIONHTAISA-N |
| XLogP | 6.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|