C20H40O2 — CID 54492785
7-[(1R,2S)-2-octylcyclopentyl]heptane-1,6-diol (PubChem CID 54492785) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 7-[(1R,2S)-2-octylcyclopentyl]heptane-1,6-diol.
| Compound Name | 7-[(1R,2S)-2-octylcyclopentyl]heptane-1,6-diol |
|---|---|
| PubChem CID | 54492785 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 7-[(1R,2S)-2-octylcyclopentyl]heptane-1,6-diol |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1CC(O)CCCCCO |
| InChI | InChI=1S/C20H40O2/c1-2-3-4-5-6-8-12-18-13-11-14-19(18)17-20(22)15-9-7-10-16-21/h18-22H,2-17H2,1H3/t18-,19+,20?/m0/s1 |
| InChIKey | XWYFPZNRFPPBSF-ABZYKWASSA-N |
| XLogP | 5.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|