About formic acid;1-heptyl-2-octylcyclopentane;methane
formic acid;1-heptyl-2-octylcyclopentane;methane (PubChem CID 158445851) has the molecular formula C22H46O2
and a molecular weight of 342.61 g/mol. Its IUPAC name is formic acid;1-heptyl-2-octylcyclopentane;methane.
Molecular Properties
| Compound Name | formic acid;1-heptyl-2-octylcyclopentane;methane |
| PubChem CID | 158445851 |
| Molecular Formula | C22H46O2 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.35 |
| IUPAC Name | formic acid;1-heptyl-2-octylcyclopentane;methane |
| SMILES | C.CCCCCCCCC1CCCC1CCCCCCC.O=CO |
| InChI | InChI=1S/C20H40.CH2O2.CH4/c1-3-5-7-9-11-13-16-20-18-14-17-19(20)15-12-10-8-6-4-2;2-1-3;/h19-20H,3-18H2,1-2H3;1H,(H,2,3);1H4 |
| InChIKey | HDJODYJXHAPKEX-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1-heptyl-2-octylcyclopentane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1-heptyl-2-octylcyclopentane;methane?
The IUPAC name of formic acid;1-heptyl-2-octylcyclopentane;methane (CID 158445851) is formic acid;1-heptyl-2-octylcyclopentane;methane.
What is the SMILES notation for formic acid;1-heptyl-2-octylcyclopentane;methane?
The canonical SMILES for formic acid;1-heptyl-2-octylcyclopentane;methane is C.CCCCCCCCC1CCCC1CCCCCCC.O=CO.
What is the InChIKey of formic acid;1-heptyl-2-octylcyclopentane;methane?
The InChIKey is HDJODYJXHAPKEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40.CH2O2.CH4/c1-3-5-7-9-11-13-16-20-18-14-17-19(20)15-12-10-8-6-4-2;2-1-3;/h19-20H,3-18H2,1-2H3;1H,(H,2,3);1H4.
What are the key properties of formic acid;1-heptyl-2-octylcyclopentane;methane?
formic acid;1-heptyl-2-octylcyclopentane;methane has a molecular weight of 342.61 g/mol, XLogP of 7.85, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1-heptyl-2-octylcyclopentane;methane is sourced from PubChem (CID 158445851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).