C14H28 — CID 175197427
trans-(1S,2S)-1-ethyl-2-heptylcyclopentane (PubChem CID 175197427) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is trans-(1S,2S)-1-ethyl-2-heptylcyclopentane.
| Compound Name | trans-(1S,2S)-1-ethyl-2-heptylcyclopentane |
|---|---|
| PubChem CID | 175197427 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | trans-(1S,2S)-1-ethyl-2-heptylcyclopentane |
| SMILES | CCCCCCC[C@H]1CCC[C@@H]1CC |
| InChI | InChI=1S/C14H28/c1-3-5-6-7-8-10-14-12-9-11-13(14)4-2/h13-14H,3-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | DUBCGYMRWHUHRM-KBPBESRZSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|