C12H24 — CID 14574886
trans-(1R,2R)-1-butyl-2-propylcyclopentane (PubChem CID 14574886) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is trans-(1R,2R)-1-butyl-2-propylcyclopentane.
| Compound Name | trans-(1R,2R)-1-butyl-2-propylcyclopentane |
|---|---|
| PubChem CID | 14574886 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | trans-(1R,2R)-1-butyl-2-propylcyclopentane |
| SMILES | CCCC[C@@H]1CCC[C@H]1CCC |
| InChI | InChI=1S/C12H24/c1-3-5-8-12-10-6-9-11(12)7-4-2/h11-12H,3-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | WYTQXVUYUANSKO-VXGBXAGGSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |