C12H24 — CID 143217114
cis-(1S,2R)-1,2-dipropylcyclohexane (PubChem CID 143217114) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is cis-(1S,2R)-1,2-dipropylcyclohexane.
| Compound Name | cis-(1S,2R)-1,2-dipropylcyclohexane |
|---|---|
| PubChem CID | 143217114 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | cis-(1S,2R)-1,2-dipropylcyclohexane |
| SMILES | CCC[C@@H]1CCCC[C@@H]1CCC |
| InChI | InChI=1S/C12H24/c1-3-7-11-9-5-6-10-12(11)8-4-2/h11-12H,3-10H2,1-2H3/t11-,12+ |
| InChIKey | ABNVRGNXKSTEOK-TXEJJXNPSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |