C11H22O — CID 94034878
trans-(1S,2R)-1-ethoxy-2-propylcyclohexane (PubChem CID 94034878) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is trans-(1S,2R)-1-ethoxy-2-propylcyclohexane.
| Compound Name | trans-(1S,2R)-1-ethoxy-2-propylcyclohexane |
|---|---|
| PubChem CID | 94034878 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | trans-(1S,2R)-1-ethoxy-2-propylcyclohexane |
| SMILES | CCC[C@@H]1CCCC[C@@H]1OCC |
| InChI | InChI=1S/C11H22O/c1-3-7-10-8-5-6-9-11(10)12-4-2/h10-11H,3-9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | NXNDAIVXGFTJFH-MNOVXSKESA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |