C10H20O2 — CID 13170081
trans-(1R,2R)-1,2-diethoxycyclohexane (PubChem CID 13170081) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is trans-(1R,2R)-1,2-diethoxycyclohexane.
| Compound Name | trans-(1R,2R)-1,2-diethoxycyclohexane |
|---|---|
| PubChem CID | 13170081 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | trans-(1R,2R)-1,2-diethoxycyclohexane |
| SMILES | CCO[C@@H]1CCCC[C@H]1OCC |
| InChI | InChI=1S/C10H20O2/c1-3-11-9-7-5-6-8-10(9)12-4-2/h9-10H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | MJONXQBPXHNGIM-NXEZZACHSA-N |
| XLogP | 2.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |